Rules for naming organic compounds-alkanes
1. Identify the longest hydrocarbon chain in the compound. If there are two chains with the same number of carbons, use the one with the most substituents.
2. Number each carbon in the chain, starting with the carbon closest to the first branch in the compound. This ensures that the end result must be that the numbers used in the name are the lowest possible numbers. Name this branch based on the number of carbons.
3. For alkanes, add –ane to the name given in part 2.
4. Identify branches on the main chain, and name them.
a.
Branches are named by counting the number of carbons and adding –yl to the name determined based on the number.
5. Now combine the name of the longest chain with the names of the branches. This is done by listing the branches in alphabetical order and putting the name of the longest change of at the end of the name. Also, in front of each branch name, add the number of the carbon that the branch is attached to.
6. If there are multiple and identical branches, such as two methyl groups, the prefixes di-, tri- must be used, and the number of the carbon which the groups are attached to are listed in order (smallest number first). Note: the prefixes di-, tri- do not count in the alphabetical order for linking.
For example: CH3CH(CH3)CH(C2H5)CH(CH3)CH
1. (The longest chain is highlighted above)
2. The branch is numbered above. There are 5 carbons in the longest chain, so it is pent-
3. The chain is an alkane since it has only singles bonds; it is named using pent- and –ane, so the name is pentane.
4. There are three branches attached to the main chain, methyl attached to carbon 2, methyl attached to carbon 4 and ethyl attached to carbon 3.
5. and
6. There are two methyl groups so they are listed as 4-ethyl-2,4-dimethlypentane. Note that ethyl is listed before dimethly because the di-, tri- prefixes do not count in the alphabetical listing, that (-) is used between numbers and words and (,) is used between numbers, and that the name of the longest chain is placed at the end of the alkanes name.
6. Final answer: 4-ethyl-2,4-dimethlypentane.
Bookmarks