Ameeratul Layl's Science Corner

as salaamu alaykum

Asking for an explanation without conducting preliminary investigation? Totally un-scientific behaviour!
Click to expand...

EDITED..IMMA ZIP IT :X
 
Last edited:
amirah_87 said:
as salaamu alaykum



LOOOOL......this is like the Geek's corner of LI (J/K!!) ;D;D

Ameerah..what's up with all this maths and science corners, skools up...burn your book darling!!!

so what is it you want discussed??
Click to expand...

:sl:
The name is Ameeratul layl.

Burn my book? No.:offended:

:w:
 
ass salaamu alaykum

whatever all the same innnit....:D

so what's this thread created for ...to share all your new scientific results from ya researches or sumthing....:?:?
 
:sl:

Finding naming alkanes and alkenes a bit of a :heated: <<that yellow thing says it all.

Could someone provide SIMPLE rules and examples please.

Much appreciated!

:w:
jazakAllah
 
:sl:

i have my science mocks tomorrow...i am sooo dreading it :(...especially since we still have 4 more modules :-\...i cant do them all on my own!...but my mums expecting atleast an A...i really dont know what to do...and especially the genetics and stuff...im soo confused :-\

:w:
 
+*Glacier*+ said:
:sl:

i have my science mocks tomorrow...i am sooo dreading it :(...especially since we still have 4 more modules :-\...i cant do them all on my own!...but my mums expecting atleast an A...i really dont know what to do...and especially the genetics and stuff...im soo confused :-\

:w:
Click to expand...

:sl:
Tomorrow? Ya Rab!
Are you doing a levels or gcse?
 
:sl:
Here's how i learnt it... got it from a neat textbook..

1. (Prefix) Identify the longest carbon chain...

1 carbon = meth-
2 carbons = eth-
3 carbons = prop-
4 carbons = but-
5 carbons = pent-
6 carbons = hex-
7 carbons = hept-
8 carbons = oct-
​
2. "Middix" Identify the type of bonding in the chain or ring.

All single bonds in the carbon chain= -an-

One double bond in the carbon chain = -en-

One triple bond in the carbon chain = -yn-
​
3. (Suffix) Identify the functional group joined to teh chain or ring.

For alkanes.. only one Hydrogen is connected to teh chane = -e
​
Exampel:

C2H6

The longest carbon chain contains 2 carbons
----> Prefix: eth-

all the bonds are single CH bonds...
----> "Middix": -an-

The functional group is one hydrogen...
----> Suffix: -e

Putting it together... eth-an-e

Ethane :D



:w:
 
salam,

sis glacier, what are you finding diificult. Im doing a levels so should be ale to help. inshAllah.

br lolwateveeeerr, the example of 'ethene' is very easy. How about when it comes to more complex stuff like: methyl propane. Arghhhhh
 
Ameeratul Layl said:
sis glacier, what are you finding diificult. Im doing a levels so should be ale to help. inshAllah.
Click to expand...

:sl:

remembering the uses of different plymerised alkaned/alkenes...what was the posh name again...or did it not have any :?...i forgot :-\...and the genetics stuff in biology...the human genome project...meiosis and mitosis...easy but confusing...the function of certain hormones...the FSH and LH stuff....and many more :-\

:w:
 
+*Glacier*+ said:
:sl:

remembering the uses of different plymerised alkaned/alkenes...what was the posh name again...or did it not have any :?...i forgot :-\...and the genetics stuff in biology...the human genome project...meiosis and mitosis...easy but confusing...the function of certain hormones...the FSH and LH stuff....and many more :-\

:w:
Click to expand...

:sl:

what do you want to start with first?
 
Last edited:
Ameeratul Layl said:
br lolwateveeeerr, the example of 'ethene' is very easy. How about when it comes to more complex stuff like: methyl propane. Arghhhhh
Click to expand...

:sl:

I hope this helps, I did some chem tutoring, and I wrote this up for my student:

Rules for naming organic compounds-alkanes

1. Identify the longest hydrocarbon chain in the compound. If there are two chains with the same number of carbons, use the one with the most substituents.
2. Number each carbon in the chain, starting with the carbon closest to the first branch in the compound. This ensures that the end result must be that the numbers used in the name are the lowest possible numbers. Name this branch based on the number of carbons.
3. For alkanes, add –ane to the name given in part 2.
4. Identify branches on the main chain, and name them.
a.​
Branches are named by counting the number of carbons and adding –yl to the name determined based on the number.
5. Now combine the name of the longest chain with the names of the branches. This is done by listing the branches in alphabetical order and putting the name of the longest change of at the end of the name. Also, in front of each branch name, add the number of the carbon that the branch is attached to.
6. If there are multiple and identical branches, such as two methyl groups, the prefixes di-, tri- must be used, and the number of the carbon which the groups are attached to are listed in order (smallest number first). Note: the prefixes di-, tri- do not count in the alphabetical order for linking.

For example: CH3CH(CH3)CH(C2H5)CH(CH3)CH



1. (The longest chain is highlighted above)
2. The branch is numbered above. There are 5 carbons in the longest chain, so it is pent-
3. The chain is an alkane since it has only singles bonds; it is named using pent- and –ane, so the name is pentane.
4. There are three branches attached to the main chain, methyl attached to carbon 2, methyl attached to carbon 4 and ethyl attached to carbon 3.
5. and 6. There are two methyl groups so they are listed as 4-ethyl-2,4-dimethlypentane. Note that ethyl is listed before dimethly because the di-, tri- prefixes do not count in the alphabetical listing, that (-) is used between numbers and words and (,) is used between numbers, and that the name of the longest chain is placed at the end of the alkanes name.
6. Final answer: 4-ethyl-2,4-dimethlypentane.
​

Rules for naming organic compounds- alkenes and alkynes.

This is basically the same as naming alkanes:

1. Instead of using –ane, simply use –ene for alkenes and –yne for alkynes.
2. The longest chain is numbered starting from the end closest to the double/triple bond.
3. For alkenes/alkynes with more than three carbon atoms in the longest chain, the location of the double bond must be specified in the name of the compound. This is done by specifying the number of the lowest-numbered carbon involved in the double bond.
​

I got heaps more for functional groups if you need some inshaallah.
 

Similar Threads

Back
Top